C17H27NaO6 — CID 23676793
sodium 1-[(E)-2-(2-methoxyethoxymethyl)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]cyclopentane-1-carboxylate (PubChem CID 23676793) has the molecular formula C17H27NaO6 and a molecular weight of 350.39 g/mol. Its IUPAC name is sodium 1-[(E)-2-(2-methoxyethoxymethyl)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]cyclopentane-1-carboxylate.
| Compound Name | sodium 1-[(E)-2-(2-methoxyethoxymethyl)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 23676793 |
| Molecular Formula | C17H27NaO6 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | sodium 1-[(E)-2-(2-methoxyethoxymethyl)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]cyclopentane-1-carboxylate |
| SMILES | COCCOC/C(=C\C1(C(=O)[O-])CCCC1)C(=O)OC(C)(C)C.[Na+] |
| InChI | InChI=1S/C17H28O6.Na/c1-16(2,3)23-14(18)13(12-22-10-9-21-4)11-17(15(19)20)7-5-6-8-17;/h11H,5-10,12H2,1-4H3,(H,19,20);/q;+1/p-1/b13-11+; |
| InChIKey | VAIVETYWFHBBFC-BNSHTTSQSA-M |
| XLogP | -1.77 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|