potassium oxido-oxo-phenylphosphanium

C6H5KO2P+ — CID 23677731

IUPACpotassium oxido-oxo-phenylphosphanium
SMILESO=[P+]([O-])c1ccccc1.[K+]
InChIInChI=1S/C6H5O2P.K/c7-9(8)6-4-2-1-3-5-6;/h1-5H;/q;+1
InChIKeyQBJPPXCADWBJST-UHFFFAOYSA-N
MW179.18 g/mol
LogP-2.58
Rot. Bonds1

About potassium oxido-oxo-phenylphosphanium

potassium oxido-oxo-phenylphosphanium (PubChem CID 23677731) has the molecular formula C6H5KO2P+ and a molecular weight of 179.18 g/mol. Its IUPAC name is potassium oxido-oxo-phenylphosphanium.

Molecular Properties

Compound Namepotassium oxido-oxo-phenylphosphanium
PubChem CID23677731
Molecular FormulaC6H5KO2P+
Molecular Weight179.18 g/mol
Exact Mass178.97
IUPAC Namepotassium oxido-oxo-phenylphosphanium
SMILESO=[P+]([O-])c1ccccc1.[K+]
InChIInChI=1S/C6H5O2P.K/c7-9(8)6-4-2-1-3-5-6;/h1-5H;/q;+1
InChIKeyQBJPPXCADWBJST-UHFFFAOYSA-N
XLogP-2.58
TPSA40.13 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.18
LogP ≤ 5-2.58
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze potassium oxido-oxo-phenylphosphanium with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium oxido-oxo-phenylphosphanium?
The IUPAC name of potassium oxido-oxo-phenylphosphanium (CID 23677731) is potassium oxido-oxo-phenylphosphanium.
What is the SMILES notation for potassium oxido-oxo-phenylphosphanium?
The canonical SMILES for potassium oxido-oxo-phenylphosphanium is O=[P+]([O-])c1ccccc1.[K+].
What is the InChIKey of potassium oxido-oxo-phenylphosphanium?
The InChIKey is QBJPPXCADWBJST-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5O2P.K/c7-9(8)6-4-2-1-3-5-6;/h1-5H;/q;+1.
What are the key properties of potassium oxido-oxo-phenylphosphanium?
potassium oxido-oxo-phenylphosphanium has a molecular weight of 179.18 g/mol, XLogP of -2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium oxido-oxo-phenylphosphanium is sourced from PubChem (CID 23677731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).