About sodium (5-amino-1,3,4-thiadiazol-2-yl)-difluoromethanesulfonate
sodium (5-amino-1,3,4-thiadiazol-2-yl)-difluoromethanesulfonate (PubChem CID 23677820) has the molecular formula C3H2F2N3NaO3S2
and a molecular weight of 253.19 g/mol. Its IUPAC name is sodium (5-amino-1,3,4-thiadiazol-2-yl)-difluoromethanesulfonate.
Molecular Properties
| Compound Name | sodium (5-amino-1,3,4-thiadiazol-2-yl)-difluoromethanesulfonate |
| PubChem CID | 23677820 |
| Molecular Formula | C3H2F2N3NaO3S2 |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 252.94 |
| IUPAC Name | sodium (5-amino-1,3,4-thiadiazol-2-yl)-difluoromethanesulfonate |
| SMILES | Nc1nnc(C(F)(F)S(=O)(=O)[O-])s1.[Na+] |
| InChI | InChI=1S/C3H3F2N3O3S2.Na/c4-3(5,13(9,10)11)1-7-8-2(6)12-1;/h(H2,6,8)(H,9,10,11);/q;+1/p-1 |
| InChIKey | YTALPAXRWDOOJN-UHFFFAOYSA-M |
| XLogP | -3.28 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium (5-amino-1,3,4-thiadiazol-2-yl)-difluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (5-amino-1,3,4-thiadiazol-2-yl)-difluoromethanesulfonate?
The IUPAC name of sodium (5-amino-1,3,4-thiadiazol-2-yl)-difluoromethanesulfonate (CID 23677820) is sodium (5-amino-1,3,4-thiadiazol-2-yl)-difluoromethanesulfonate.
What is the SMILES notation for sodium (5-amino-1,3,4-thiadiazol-2-yl)-difluoromethanesulfonate?
The canonical SMILES for sodium (5-amino-1,3,4-thiadiazol-2-yl)-difluoromethanesulfonate is Nc1nnc(C(F)(F)S(=O)(=O)[O-])s1.[Na+].
What is the InChIKey of sodium (5-amino-1,3,4-thiadiazol-2-yl)-difluoromethanesulfonate?
The InChIKey is YTALPAXRWDOOJN-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H3F2N3O3S2.Na/c4-3(5,13(9,10)11)1-7-8-2(6)12-1;/h(H2,6,8)(H,9,10,11);/q;+1/p-1.
What are the key properties of sodium (5-amino-1,3,4-thiadiazol-2-yl)-difluoromethanesulfonate?
sodium (5-amino-1,3,4-thiadiazol-2-yl)-difluoromethanesulfonate has a molecular weight of 253.19 g/mol, XLogP of -3.28, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (5-amino-1,3,4-thiadiazol-2-yl)-difluoromethanesulfonate is sourced from PubChem (CID 23677820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).