About sodium 2-ethoxy-2-oxoethanolate
sodium 2-ethoxy-2-oxoethanolate (PubChem CID 23677885) has the molecular formula C4H7NaO3
and a molecular weight of 126.09 g/mol. Its IUPAC name is sodium 2-ethoxy-2-oxoethanolate.
Molecular Properties
| Compound Name | sodium 2-ethoxy-2-oxoethanolate |
| PubChem CID | 23677885 |
| Molecular Formula | C4H7NaO3 |
| Molecular Weight | 126.09 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | sodium 2-ethoxy-2-oxoethanolate |
| SMILES | CCOC(=O)C[O-].[Na+] |
| InChI | InChI=1S/C4H7O3.Na/c1-2-7-4(6)3-5;/h2-3H2,1H3;/q-1;+1 |
| InChIKey | XHPLMWCOBFTCBJ-UHFFFAOYSA-N |
| XLogP | -4.09 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.09 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium 2-ethoxy-2-oxoethanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-ethoxy-2-oxoethanolate?
The IUPAC name of sodium 2-ethoxy-2-oxoethanolate (CID 23677885) is sodium 2-ethoxy-2-oxoethanolate.
What is the SMILES notation for sodium 2-ethoxy-2-oxoethanolate?
The canonical SMILES for sodium 2-ethoxy-2-oxoethanolate is CCOC(=O)C[O-].[Na+].
What is the InChIKey of sodium 2-ethoxy-2-oxoethanolate?
The InChIKey is XHPLMWCOBFTCBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7O3.Na/c1-2-7-4(6)3-5;/h2-3H2,1H3;/q-1;+1.
What are the key properties of sodium 2-ethoxy-2-oxoethanolate?
sodium 2-ethoxy-2-oxoethanolate has a molecular weight of 126.09 g/mol, XLogP of -4.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-ethoxy-2-oxoethanolate is sourced from PubChem (CID 23677885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).