About sodium 4-ethyl-2,3-dihydro-1,4-benzothiazine-2-carboxylate
sodium 4-ethyl-2,3-dihydro-1,4-benzothiazine-2-carboxylate (PubChem CID 23678320) has the molecular formula C11H12NNaO2S
and a molecular weight of 245.28 g/mol. Its IUPAC name is sodium 4-ethyl-2,3-dihydro-1,4-benzothiazine-2-carboxylate.
Molecular Properties
| Compound Name | sodium 4-ethyl-2,3-dihydro-1,4-benzothiazine-2-carboxylate |
| PubChem CID | 23678320 |
| Molecular Formula | C11H12NNaO2S |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | sodium 4-ethyl-2,3-dihydro-1,4-benzothiazine-2-carboxylate |
| SMILES | CCN1CC(C(=O)[O-])Sc2ccccc21.[Na+] |
| InChI | InChI=1S/C11H13NO2S.Na/c1-2-12-7-10(11(13)14)15-9-6-4-3-5-8(9)12;/h3-6,10H,2,7H2,1H3,(H,13,14);/q;+1/p-1 |
| InChIKey | IWZYVUWLNNIHOE-UHFFFAOYSA-M |
| XLogP | -2.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium 4-ethyl-2,3-dihydro-1,4-benzothiazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-ethyl-2,3-dihydro-1,4-benzothiazine-2-carboxylate?
The IUPAC name of sodium 4-ethyl-2,3-dihydro-1,4-benzothiazine-2-carboxylate (CID 23678320) is sodium 4-ethyl-2,3-dihydro-1,4-benzothiazine-2-carboxylate.
What is the SMILES notation for sodium 4-ethyl-2,3-dihydro-1,4-benzothiazine-2-carboxylate?
The canonical SMILES for sodium 4-ethyl-2,3-dihydro-1,4-benzothiazine-2-carboxylate is CCN1CC(C(=O)[O-])Sc2ccccc21.[Na+].
What is the InChIKey of sodium 4-ethyl-2,3-dihydro-1,4-benzothiazine-2-carboxylate?
The InChIKey is IWZYVUWLNNIHOE-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H13NO2S.Na/c1-2-12-7-10(11(13)14)15-9-6-4-3-5-8(9)12;/h3-6,10H,2,7H2,1H3,(H,13,14);/q;+1/p-1.
What are the key properties of sodium 4-ethyl-2,3-dihydro-1,4-benzothiazine-2-carboxylate?
sodium 4-ethyl-2,3-dihydro-1,4-benzothiazine-2-carboxylate has a molecular weight of 245.28 g/mol, XLogP of -2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-ethyl-2,3-dihydro-1,4-benzothiazine-2-carboxylate is sourced from PubChem (CID 23678320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).