About potassium (5R)-5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-oxofuran-2-olate
potassium (5R)-5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-oxofuran-2-olate (PubChem CID 23678409) has the molecular formula C6H7KO6
and a molecular weight of 214.21 g/mol. Its IUPAC name is potassium (5R)-5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-oxofuran-2-olate.
Molecular Properties
| Compound Name | potassium (5R)-5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-oxofuran-2-olate |
| PubChem CID | 23678409 |
| Molecular Formula | C6H7KO6 |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | potassium (5R)-5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-oxofuran-2-olate |
| SMILES | O=C1C(O)=C([O-])O[C@@H]1[C@@H](O)CO.[K+] |
| InChI | InChI=1S/C6H8O6.K/c7-1-2(8)5-3(9)4(10)6(11)12-5;/h2,5,7-8,10-11H,1H2;/q;+1/p-1/t2-,5+;/m0./s1 |
| InChIKey | FKSJFWGPTAUCJL-RXSVEWSESA-M |
| XLogP | -5.60 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | -5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze potassium (5R)-5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-oxofuran-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium (5R)-5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-oxofuran-2-olate?
The IUPAC name of potassium (5R)-5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-oxofuran-2-olate (CID 23678409) is potassium (5R)-5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-oxofuran-2-olate.
What is the SMILES notation for potassium (5R)-5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-oxofuran-2-olate?
The canonical SMILES for potassium (5R)-5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-oxofuran-2-olate is O=C1C(O)=C([O-])O[C@@H]1[C@@H](O)CO.[K+].
What is the InChIKey of potassium (5R)-5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-oxofuran-2-olate?
The InChIKey is FKSJFWGPTAUCJL-RXSVEWSESA-M. The full InChI is InChI=1S/C6H8O6.K/c7-1-2(8)5-3(9)4(10)6(11)12-5;/h2,5,7-8,10-11H,1H2;/q;+1/p-1/t2-,5+;/m0./s1.
What are the key properties of potassium (5R)-5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-oxofuran-2-olate?
potassium (5R)-5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-oxofuran-2-olate has a molecular weight of 214.21 g/mol, XLogP of -5.60, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (5R)-5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-oxofuran-2-olate is sourced from PubChem (CID 23678409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).