C18H27NaO5 — CID 23678668
sodium (3R,5R)-7-[(1R,2R,8aR)-2-methyl-3-oxo-2,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]-3,5-dihydroxyheptanoate (PubChem CID 23678668) has the molecular formula C18H27NaO5 and a molecular weight of 346.40 g/mol. Its IUPAC name is sodium (3R,5R)-7-[(1R,2R,8aR)-2-methyl-3-oxo-2,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]-3,5-dihydroxyheptanoate.
| Compound Name | sodium (3R,5R)-7-[(1R,2R,8aR)-2-methyl-3-oxo-2,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]-3,5-dihydroxyheptanoate |
|---|---|
| PubChem CID | 23678668 |
| Molecular Formula | C18H27NaO5 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | sodium (3R,5R)-7-[(1R,2R,8aR)-2-methyl-3-oxo-2,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]-3,5-dihydroxyheptanoate |
| SMILES | C[C@H]1C(=O)C=C2CCCC[C@@H]2[C@H]1CC[C@@H](O)C[C@@H](O)CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C18H28O5.Na/c1-11-15(7-6-13(19)9-14(20)10-18(22)23)16-5-3-2-4-12(16)8-17(11)21;/h8,11,13-16,19-20H,2-7,9-10H2,1H3,(H,22,23);/q;+1/p-1/t11-,13-,14-,15+,16+;/m1./s1 |
| InChIKey | XDRMSYCGZONCLK-CTLLHZBHSA-M |
| XLogP | -2.03 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |