C18H29NaO5S — CID 23678864
sodium 2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethanesulfonate (PubChem CID 23678864) has the molecular formula C18H29NaO5S and a molecular weight of 380.48 g/mol. Its IUPAC name is sodium 2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethanesulfonate.
| Compound Name | sodium 2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethanesulfonate |
|---|---|
| PubChem CID | 23678864 |
| Molecular Formula | C18H29NaO5S |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | sodium 2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethanesulfonate |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCCOCCS(=O)(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C18H30O5S.Na/c1-17(2,3)14-18(4,5)15-6-8-16(9-7-15)23-11-10-22-12-13-24(19,20)21;/h6-9H,10-14H2,1-5H3,(H,19,20,21);/q;+1/p-1 |
| InChIKey | XBMBHKZYEXQONC-UHFFFAOYSA-M |
| XLogP | 0.34 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|