About potassium 2-hydroxy-3,3-dimethylbicyclo[2.2.1]heptane-1-carboxylate
potassium 2-hydroxy-3,3-dimethylbicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 23679227) has the molecular formula C10H15KO3
and a molecular weight of 222.32 g/mol. Its IUPAC name is potassium 2-hydroxy-3,3-dimethylbicyclo[2.2.1]heptane-1-carboxylate.
Molecular Properties
| Compound Name | potassium 2-hydroxy-3,3-dimethylbicyclo[2.2.1]heptane-1-carboxylate |
| PubChem CID | 23679227 |
| Molecular Formula | C10H15KO3 |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | potassium 2-hydroxy-3,3-dimethylbicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC1(C)C2CCC(C(=O)[O-])(C2)C1O.[K+] |
| InChI | InChI=1S/C10H16O3.K/c1-9(2)6-3-4-10(5-6,7(9)11)8(12)13;/h6-7,11H,3-5H2,1-2H3,(H,12,13);/q;+1/p-1 |
| InChIKey | UFIWBABLZWTLAE-UHFFFAOYSA-M |
| XLogP | -3.07 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium 2-hydroxy-3,3-dimethylbicyclo[2.2.1]heptane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-hydroxy-3,3-dimethylbicyclo[2.2.1]heptane-1-carboxylate?
The IUPAC name of potassium 2-hydroxy-3,3-dimethylbicyclo[2.2.1]heptane-1-carboxylate (CID 23679227) is potassium 2-hydroxy-3,3-dimethylbicyclo[2.2.1]heptane-1-carboxylate.
What is the SMILES notation for potassium 2-hydroxy-3,3-dimethylbicyclo[2.2.1]heptane-1-carboxylate?
The canonical SMILES for potassium 2-hydroxy-3,3-dimethylbicyclo[2.2.1]heptane-1-carboxylate is CC1(C)C2CCC(C(=O)[O-])(C2)C1O.[K+].
What is the InChIKey of potassium 2-hydroxy-3,3-dimethylbicyclo[2.2.1]heptane-1-carboxylate?
The InChIKey is UFIWBABLZWTLAE-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H16O3.K/c1-9(2)6-3-4-10(5-6,7(9)11)8(12)13;/h6-7,11H,3-5H2,1-2H3,(H,12,13);/q;+1/p-1.
What are the key properties of potassium 2-hydroxy-3,3-dimethylbicyclo[2.2.1]heptane-1-carboxylate?
potassium 2-hydroxy-3,3-dimethylbicyclo[2.2.1]heptane-1-carboxylate has a molecular weight of 222.32 g/mol, XLogP of -3.07, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-hydroxy-3,3-dimethylbicyclo[2.2.1]heptane-1-carboxylate is sourced from PubChem (CID 23679227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).