About potassium (4-hydroxyphenyl) sulfate
potassium (4-hydroxyphenyl) sulfate (PubChem CID 23679873) has the molecular formula C6H5KO5S
and a molecular weight of 228.27 g/mol. Its IUPAC name is potassium (4-hydroxyphenyl) sulfate.
Molecular Properties
| Compound Name | potassium (4-hydroxyphenyl) sulfate |
| PubChem CID | 23679873 |
| Molecular Formula | C6H5KO5S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 227.95 |
| IUPAC Name | potassium (4-hydroxyphenyl) sulfate |
| SMILES | O=S(=O)([O-])Oc1ccc(O)cc1.[K+] |
| InChI | InChI=1S/C6H6O5S.K/c7-5-1-3-6(4-2-5)11-12(8,9)10;/h1-4,7H,(H,8,9,10);/q;+1/p-1 |
| InChIKey | KYQHUXZXYUBUPX-UHFFFAOYSA-M |
| XLogP | -2.76 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze potassium (4-hydroxyphenyl) sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium (4-hydroxyphenyl) sulfate?
The IUPAC name of potassium (4-hydroxyphenyl) sulfate (CID 23679873) is potassium (4-hydroxyphenyl) sulfate.
What is the SMILES notation for potassium (4-hydroxyphenyl) sulfate?
The canonical SMILES for potassium (4-hydroxyphenyl) sulfate is O=S(=O)([O-])Oc1ccc(O)cc1.[K+].
What is the InChIKey of potassium (4-hydroxyphenyl) sulfate?
The InChIKey is KYQHUXZXYUBUPX-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6O5S.K/c7-5-1-3-6(4-2-5)11-12(8,9)10;/h1-4,7H,(H,8,9,10);/q;+1/p-1.
What are the key properties of potassium (4-hydroxyphenyl) sulfate?
potassium (4-hydroxyphenyl) sulfate has a molecular weight of 228.27 g/mol, XLogP of -2.76, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (4-hydroxyphenyl) sulfate is sourced from PubChem (CID 23679873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).