About potassium 5-bromo-2-chlorobenzoate
potassium 5-bromo-2-chlorobenzoate (PubChem CID 23680159) has the molecular formula C7H3BrClKO2
and a molecular weight of 273.55 g/mol. Its IUPAC name is potassium 5-bromo-2-chlorobenzoate.
Molecular Properties
| Compound Name | potassium 5-bromo-2-chlorobenzoate |
| PubChem CID | 23680159 |
| Molecular Formula | C7H3BrClKO2 |
| Molecular Weight | 273.55 g/mol |
| Exact Mass | 271.86 |
| IUPAC Name | potassium 5-bromo-2-chlorobenzoate |
| SMILES | O=C([O-])c1cc(Br)ccc1Cl.[K+] |
| InChI | InChI=1S/C7H4BrClO2.K/c8-4-1-2-6(9)5(3-4)7(10)11;/h1-3H,(H,10,11);/q;+1/p-1 |
| InChIKey | WXFJAGOKTHQWOD-UHFFFAOYSA-M |
| XLogP | -1.53 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.55 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium 5-bromo-2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 5-bromo-2-chlorobenzoate?
The IUPAC name of potassium 5-bromo-2-chlorobenzoate (CID 23680159) is potassium 5-bromo-2-chlorobenzoate.
What is the SMILES notation for potassium 5-bromo-2-chlorobenzoate?
The canonical SMILES for potassium 5-bromo-2-chlorobenzoate is O=C([O-])c1cc(Br)ccc1Cl.[K+].
What is the InChIKey of potassium 5-bromo-2-chlorobenzoate?
The InChIKey is WXFJAGOKTHQWOD-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H4BrClO2.K/c8-4-1-2-6(9)5(3-4)7(10)11;/h1-3H,(H,10,11);/q;+1/p-1.
What are the key properties of potassium 5-bromo-2-chlorobenzoate?
potassium 5-bromo-2-chlorobenzoate has a molecular weight of 273.55 g/mol, XLogP of -1.53, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 5-bromo-2-chlorobenzoate is sourced from PubChem (CID 23680159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).