About sodium anilinomethanesulfonate
sodium anilinomethanesulfonate (PubChem CID 23680200) has the molecular formula C7H8NNaO3S
and a molecular weight of 209.20 g/mol. Its IUPAC name is sodium anilinomethanesulfonate.
Molecular Properties
| Compound Name | sodium anilinomethanesulfonate |
| PubChem CID | 23680200 |
| Molecular Formula | C7H8NNaO3S |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | sodium anilinomethanesulfonate |
| SMILES | O=S(=O)([O-])CNc1ccccc1.[Na+] |
| InChI | InChI=1S/C7H9NO3S.Na/c9-12(10,11)6-8-7-4-2-1-3-5-7;/h1-5,8H,6H2,(H,9,10,11);/q;+1/p-1 |
| InChIKey | AJSINQAAKNYUDA-UHFFFAOYSA-M |
| XLogP | -2.39 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium anilinomethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium anilinomethanesulfonate?
The IUPAC name of sodium anilinomethanesulfonate (CID 23680200) is sodium anilinomethanesulfonate.
What is the SMILES notation for sodium anilinomethanesulfonate?
The canonical SMILES for sodium anilinomethanesulfonate is O=S(=O)([O-])CNc1ccccc1.[Na+].
What is the InChIKey of sodium anilinomethanesulfonate?
The InChIKey is AJSINQAAKNYUDA-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H9NO3S.Na/c9-12(10,11)6-8-7-4-2-1-3-5-7;/h1-5,8H,6H2,(H,9,10,11);/q;+1/p-1.
What are the key properties of sodium anilinomethanesulfonate?
sodium anilinomethanesulfonate has a molecular weight of 209.20 g/mol, XLogP of -2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium anilinomethanesulfonate is sourced from PubChem (CID 23680200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).