About sodium 2-cyanoethanesulfonate
sodium 2-cyanoethanesulfonate (PubChem CID 23680276) has the molecular formula C3H4NNaO3S
and a molecular weight of 157.13 g/mol. Its IUPAC name is sodium 2-cyanoethanesulfonate.
Molecular Properties
| Compound Name | sodium 2-cyanoethanesulfonate |
| PubChem CID | 23680276 |
| Molecular Formula | C3H4NNaO3S |
| Molecular Weight | 157.13 g/mol |
| Exact Mass | 156.98 |
| IUPAC Name | sodium 2-cyanoethanesulfonate |
| SMILES | N#CCCS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C3H5NO3S.Na/c4-2-1-3-8(5,6)7;/h1,3H2,(H,5,6,7);/q;+1/p-1 |
| InChIKey | OUBHSSAWQNSXCU-UHFFFAOYSA-M |
| XLogP | -3.55 |
| TPSA | 80.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.13 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-cyanoethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-cyanoethanesulfonate?
The IUPAC name of sodium 2-cyanoethanesulfonate (CID 23680276) is sodium 2-cyanoethanesulfonate.
What is the SMILES notation for sodium 2-cyanoethanesulfonate?
The canonical SMILES for sodium 2-cyanoethanesulfonate is N#CCCS(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium 2-cyanoethanesulfonate?
The InChIKey is OUBHSSAWQNSXCU-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H5NO3S.Na/c4-2-1-3-8(5,6)7;/h1,3H2,(H,5,6,7);/q;+1/p-1.
What are the key properties of sodium 2-cyanoethanesulfonate?
sodium 2-cyanoethanesulfonate has a molecular weight of 157.13 g/mol, XLogP of -3.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-cyanoethanesulfonate is sourced from PubChem (CID 23680276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).