About sodium 3-amino-2,4,6-triiodobenzoate
sodium 3-amino-2,4,6-triiodobenzoate (PubChem CID 23680393) has the molecular formula C7H3I3NNaO2
and a molecular weight of 536.81 g/mol. Its IUPAC name is sodium 3-amino-2,4,6-triiodobenzoate.
Molecular Properties
| Compound Name | sodium 3-amino-2,4,6-triiodobenzoate |
| PubChem CID | 23680393 |
| Molecular Formula | C7H3I3NNaO2 |
| Molecular Weight | 536.81 g/mol |
| Exact Mass | 536.72 |
| IUPAC Name | sodium 3-amino-2,4,6-triiodobenzoate |
| SMILES | Nc1c(I)cc(I)c(C(=O)[O-])c1I.[Na+] |
| InChI | InChI=1S/C7H4I3NO2.Na/c8-2-1-3(9)6(11)5(10)4(2)7(12)13;/h1H,11H2,(H,12,13);/q;+1/p-1 |
| InChIKey | CTXRMWPLTDAHOR-UHFFFAOYSA-M |
| XLogP | -1.55 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 536.81 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze sodium 3-amino-2,4,6-triiodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-amino-2,4,6-triiodobenzoate?
The IUPAC name of sodium 3-amino-2,4,6-triiodobenzoate (CID 23680393) is sodium 3-amino-2,4,6-triiodobenzoate.
What is the SMILES notation for sodium 3-amino-2,4,6-triiodobenzoate?
The canonical SMILES for sodium 3-amino-2,4,6-triiodobenzoate is Nc1c(I)cc(I)c(C(=O)[O-])c1I.[Na+].
What is the InChIKey of sodium 3-amino-2,4,6-triiodobenzoate?
The InChIKey is CTXRMWPLTDAHOR-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H4I3NO2.Na/c8-2-1-3(9)6(11)5(10)4(2)7(12)13;/h1H,11H2,(H,12,13);/q;+1/p-1.
What are the key properties of sodium 3-amino-2,4,6-triiodobenzoate?
sodium 3-amino-2,4,6-triiodobenzoate has a molecular weight of 536.81 g/mol, XLogP of -1.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-amino-2,4,6-triiodobenzoate is sourced from PubChem (CID 23680393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).