C20H26N3NaO4S — CID 23680470
sodium (Z)-7-[(2R,4R,5S)-2-methyl-4-[(E)-(phenylcarbamothioylhydrazinylidene)methyl]-1,3-dioxan-5-yl]hept-5-enoate (PubChem CID 23680470) has the molecular formula C20H26N3NaO4S and a molecular weight of 427.50 g/mol. Its IUPAC name is sodium (Z)-7-[(2R,4R,5S)-2-methyl-4-[(E)-(phenylcarbamothioylhydrazinylidene)methyl]-1,3-dioxan-5-yl]hept-5-enoate.
| Compound Name | sodium (Z)-7-[(2R,4R,5S)-2-methyl-4-[(E)-(phenylcarbamothioylhydrazinylidene)methyl]-1,3-dioxan-5-yl]hept-5-enoate |
|---|---|
| PubChem CID | 23680470 |
| Molecular Formula | C20H26N3NaO4S |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | sodium (Z)-7-[(2R,4R,5S)-2-methyl-4-[(E)-(phenylcarbamothioylhydrazinylidene)methyl]-1,3-dioxan-5-yl]hept-5-enoate |
| SMILES | C[C@@H]1OC[C@H](C/C=C\CCCC(=O)[O-])[C@H](/C=N/NC(=S)Nc2ccccc2)O1.[Na+] |
| InChI | InChI=1S/C20H27N3O4S.Na/c1-15-26-14-16(9-5-2-3-8-12-19(24)25)18(27-15)13-21-23-20(28)22-17-10-6-4-7-11-17;/h2,4-7,10-11,13,15-16,18H,3,8-9,12,14H2,1H3,(H,24,25)(H2,22,23,28);/q;+1/p-1/b5-2-,21-13+;/t15-,16+,18+;/m1./s1 |
| InChIKey | PONGHZILAQIURJ-RPKSWYHFSA-M |
| XLogP | -0.79 |
| TPSA | 95.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|