sodium 3-methylphenolate

C7H7NaO — CID 23681055

IUPACsodium 3-methylphenolate
SMILESCc1cccc([O-])c1.[Na+]
InChIInChI=1S/C7H8O.Na/c1-6-3-2-4-7(8)5-6;/h2-5,8H,1H3;/q;+1/p-1
InChIKeyQOINKMNRLBCJOP-UHFFFAOYSA-M
MW130.12 g/mol
LogP-1.93
Rot. Bonds

About sodium 3-methylphenolate

sodium 3-methylphenolate (PubChem CID 23681055) has the molecular formula C7H7NaO and a molecular weight of 130.12 g/mol. Its IUPAC name is sodium 3-methylphenolate.

Molecular Properties

Compound Namesodium 3-methylphenolate
PubChem CID23681055
Molecular FormulaC7H7NaO
Molecular Weight130.12 g/mol
Exact Mass130.04
IUPAC Namesodium 3-methylphenolate
SMILESCc1cccc([O-])c1.[Na+]
InChIInChI=1S/C7H8O.Na/c1-6-3-2-4-7(8)5-6;/h2-5,8H,1H3;/q;+1/p-1
InChIKeyQOINKMNRLBCJOP-UHFFFAOYSA-M
XLogP-1.93
TPSA23.06 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500130.12
LogP ≤ 5-1.93
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze sodium 3-methylphenolate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 3-methylphenolate?
The IUPAC name of sodium 3-methylphenolate (CID 23681055) is sodium 3-methylphenolate.
What is the SMILES notation for sodium 3-methylphenolate?
The canonical SMILES for sodium 3-methylphenolate is Cc1cccc([O-])c1.[Na+].
What is the InChIKey of sodium 3-methylphenolate?
The InChIKey is QOINKMNRLBCJOP-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O.Na/c1-6-3-2-4-7(8)5-6;/h2-5,8H,1H3;/q;+1/p-1.
What are the key properties of sodium 3-methylphenolate?
sodium 3-methylphenolate has a molecular weight of 130.12 g/mol, XLogP of -1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-methylphenolate is sourced from PubChem (CID 23681055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).