About sodium 3-methylphenolate
sodium 3-methylphenolate (PubChem CID 23681055) has the molecular formula C7H7NaO
and a molecular weight of 130.12 g/mol. Its IUPAC name is sodium 3-methylphenolate.
Molecular Properties
| Compound Name | sodium 3-methylphenolate |
| PubChem CID | 23681055 |
| Molecular Formula | C7H7NaO |
| Molecular Weight | 130.12 g/mol |
| Exact Mass | 130.04 |
| IUPAC Name | sodium 3-methylphenolate |
| SMILES | Cc1cccc([O-])c1.[Na+] |
| InChI | InChI=1S/C7H8O.Na/c1-6-3-2-4-7(8)5-6;/h2-5,8H,1H3;/q;+1/p-1 |
| InChIKey | QOINKMNRLBCJOP-UHFFFAOYSA-M |
| XLogP | -1.93 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.12 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium 3-methylphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-methylphenolate?
The IUPAC name of sodium 3-methylphenolate (CID 23681055) is sodium 3-methylphenolate.
What is the SMILES notation for sodium 3-methylphenolate?
The canonical SMILES for sodium 3-methylphenolate is Cc1cccc([O-])c1.[Na+].
What is the InChIKey of sodium 3-methylphenolate?
The InChIKey is QOINKMNRLBCJOP-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O.Na/c1-6-3-2-4-7(8)5-6;/h2-5,8H,1H3;/q;+1/p-1.
What are the key properties of sodium 3-methylphenolate?
sodium 3-methylphenolate has a molecular weight of 130.12 g/mol, XLogP of -1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-methylphenolate is sourced from PubChem (CID 23681055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).