About sodium 4-acetamidobenzoate
sodium 4-acetamidobenzoate (PubChem CID 23681162) has the molecular formula C9H8NNaO3
and a molecular weight of 201.16 g/mol. Its IUPAC name is sodium 4-acetamidobenzoate.
Molecular Properties
| Compound Name | sodium 4-acetamidobenzoate |
| PubChem CID | 23681162 |
| Molecular Formula | C9H8NNaO3 |
| Molecular Weight | 201.16 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | sodium 4-acetamidobenzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C9H9NO3.Na/c1-6(11)10-8-4-2-7(3-5-8)9(12)13;/h2-5H,1H3,(H,10,11)(H,12,13);/q;+1/p-1 |
| InChIKey | QCTHGBUDZUJILN-UHFFFAOYSA-M |
| XLogP | -2.99 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.16 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium 4-acetamidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-acetamidobenzoate?
The IUPAC name of sodium 4-acetamidobenzoate (CID 23681162) is sodium 4-acetamidobenzoate.
What is the SMILES notation for sodium 4-acetamidobenzoate?
The canonical SMILES for sodium 4-acetamidobenzoate is CC(=O)Nc1ccc(C(=O)[O-])cc1.[Na+].
What is the InChIKey of sodium 4-acetamidobenzoate?
The InChIKey is QCTHGBUDZUJILN-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H9NO3.Na/c1-6(11)10-8-4-2-7(3-5-8)9(12)13;/h2-5H,1H3,(H,10,11)(H,12,13);/q;+1/p-1.
What are the key properties of sodium 4-acetamidobenzoate?
sodium 4-acetamidobenzoate has a molecular weight of 201.16 g/mol, XLogP of -2.99, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-acetamidobenzoate is sourced from PubChem (CID 23681162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).