About sodium 5,5-diethyl-4,6-dioxo-1H-pyrimidin-2-olate
sodium 5,5-diethyl-4,6-dioxo-1H-pyrimidin-2-olate (PubChem CID 23681217) has the molecular formula C8H11N2NaO3
and a molecular weight of 206.18 g/mol. Its IUPAC name is sodium 5,5-diethyl-4,6-dioxo-1H-pyrimidin-2-olate.
Molecular Properties
| Compound Name | sodium 5,5-diethyl-4,6-dioxo-1H-pyrimidin-2-olate |
| PubChem CID | 23681217 |
| Molecular Formula | C8H11N2NaO3 |
| Molecular Weight | 206.18 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | sodium 5,5-diethyl-4,6-dioxo-1H-pyrimidin-2-olate |
| SMILES | CCC1(CC)C(=O)N=C([O-])NC1=O.[Na+] |
| InChI | InChI=1S/C8H12N2O3.Na/c1-3-8(4-2)5(11)9-7(13)10-6(8)12;/h3-4H2,1-2H3,(H2,9,10,11,12,13);/q;+1/p-1 |
| InChIKey | RGHFKWPGWBFQLN-UHFFFAOYSA-M |
| XLogP | -3.83 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.18 |
| LogP ≤ 5 | -3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze sodium 5,5-diethyl-4,6-dioxo-1H-pyrimidin-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 5,5-diethyl-4,6-dioxo-1H-pyrimidin-2-olate?
The IUPAC name of sodium 5,5-diethyl-4,6-dioxo-1H-pyrimidin-2-olate (CID 23681217) is sodium 5,5-diethyl-4,6-dioxo-1H-pyrimidin-2-olate.
What is the SMILES notation for sodium 5,5-diethyl-4,6-dioxo-1H-pyrimidin-2-olate?
The canonical SMILES for sodium 5,5-diethyl-4,6-dioxo-1H-pyrimidin-2-olate is CCC1(CC)C(=O)N=C([O-])NC1=O.[Na+].
What is the InChIKey of sodium 5,5-diethyl-4,6-dioxo-1H-pyrimidin-2-olate?
The InChIKey is RGHFKWPGWBFQLN-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H12N2O3.Na/c1-3-8(4-2)5(11)9-7(13)10-6(8)12;/h3-4H2,1-2H3,(H2,9,10,11,12,13);/q;+1/p-1.
What are the key properties of sodium 5,5-diethyl-4,6-dioxo-1H-pyrimidin-2-olate?
sodium 5,5-diethyl-4,6-dioxo-1H-pyrimidin-2-olate has a molecular weight of 206.18 g/mol, XLogP of -3.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 5,5-diethyl-4,6-dioxo-1H-pyrimidin-2-olate is sourced from PubChem (CID 23681217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).