About sodium 4-oxohex-5-enoate
sodium 4-oxohex-5-enoate (PubChem CID 23682589) has the molecular formula C6H7NaO3
and a molecular weight of 150.11 g/mol. Its IUPAC name is sodium 4-oxohex-5-enoate.
Molecular Properties
| Compound Name | sodium 4-oxohex-5-enoate |
| PubChem CID | 23682589 |
| Molecular Formula | C6H7NaO3 |
| Molecular Weight | 150.11 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | sodium 4-oxohex-5-enoate |
| SMILES | C=CC(=O)CCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H8O3.Na/c1-2-5(7)3-4-6(8)9;/h2H,1,3-4H2,(H,8,9);/q;+1/p-1 |
| InChIKey | KTGNXKIPQSGHOB-UHFFFAOYSA-M |
| XLogP | -3.72 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.11 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze sodium 4-oxohex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-oxohex-5-enoate?
The IUPAC name of sodium 4-oxohex-5-enoate (CID 23682589) is sodium 4-oxohex-5-enoate.
What is the SMILES notation for sodium 4-oxohex-5-enoate?
The canonical SMILES for sodium 4-oxohex-5-enoate is C=CC(=O)CCC(=O)[O-].[Na+].
What is the InChIKey of sodium 4-oxohex-5-enoate?
The InChIKey is KTGNXKIPQSGHOB-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H8O3.Na/c1-2-5(7)3-4-6(8)9;/h2H,1,3-4H2,(H,8,9);/q;+1/p-1.
What are the key properties of sodium 4-oxohex-5-enoate?
sodium 4-oxohex-5-enoate has a molecular weight of 150.11 g/mol, XLogP of -3.72, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-oxohex-5-enoate is sourced from PubChem (CID 23682589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).