About sodium 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoate
sodium 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoate (PubChem CID 23682789) has the molecular formula C19H17N4NaO8
and a molecular weight of 452.36 g/mol. Its IUPAC name is sodium 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoate.
Molecular Properties
| Compound Name | sodium 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoate |
| PubChem CID | 23682789 |
| Molecular Formula | C19H17N4NaO8 |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | sodium 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoate |
| SMILES | COc1cc(OC)nc(Oc2cccc(Oc3nc(OC)cc(OC)n3)c2C(=O)[O-])n1.[Na+] |
| InChI | InChI=1S/C19H18N4O8.Na/c1-26-12-8-13(27-2)21-18(20-12)30-10-6-5-7-11(16(10)17(24)25)31-19-22-14(28-3)9-15(23-19)29-4;/h5-9H,1-4H3,(H,24,25);/q;+1/p-1 |
| InChIKey | FUHMZYWBSHTEDZ-UHFFFAOYSA-M |
| XLogP | -1.75 |
| TPSA | 147.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Analyze sodium 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoate?
The IUPAC name of sodium 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoate (CID 23682789) is sodium 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoate.
What is the SMILES notation for sodium 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoate?
The canonical SMILES for sodium 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoate is COc1cc(OC)nc(Oc2cccc(Oc3nc(OC)cc(OC)n3)c2C(=O)[O-])n1.[Na+].
What is the InChIKey of sodium 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoate?
The InChIKey is FUHMZYWBSHTEDZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H18N4O8.Na/c1-26-12-8-13(27-2)21-18(20-12)30-10-6-5-7-11(16(10)17(24)25)31-19-22-14(28-3)9-15(23-19)29-4;/h5-9H,1-4H3,(H,24,25);/q;+1/p-1.
What are the key properties of sodium 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoate?
sodium 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoate has a molecular weight of 452.36 g/mol, XLogP of -1.75, 9 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoate is sourced from PubChem (CID 23682789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).