cesium methyl carbonate

C2H3CsO3 — CID 23683585

IUPACcesium methyl carbonate
SMILESCOC(=O)[O-].[Cs+]
InChIInChI=1S/C2H4O3.Cs/c1-5-2(3)4;/h1H3,(H,3,4);/q;+1/p-1
InChIKeyATQKOSLGXBFGRU-UHFFFAOYSA-M
MW207.95 g/mol
LogP-4.02
Rot. Bonds

About cesium methyl carbonate

cesium methyl carbonate (PubChem CID 23683585) has the molecular formula C2H3CsO3 and a molecular weight of 207.95 g/mol. Its IUPAC name is cesium methyl carbonate.

Molecular Properties

Compound Namecesium methyl carbonate
PubChem CID23683585
Molecular FormulaC2H3CsO3
Molecular Weight207.95 g/mol
Exact Mass207.91
IUPAC Namecesium methyl carbonate
SMILESCOC(=O)[O-].[Cs+]
InChIInChI=1S/C2H4O3.Cs/c1-5-2(3)4;/h1H3,(H,3,4);/q;+1/p-1
InChIKeyATQKOSLGXBFGRU-UHFFFAOYSA-M
XLogP-4.02
TPSA49.36 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.95
LogP ≤ 5-4.02
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze cesium methyl carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cesium methyl carbonate?
The IUPAC name of cesium methyl carbonate (CID 23683585) is cesium methyl carbonate.
What is the SMILES notation for cesium methyl carbonate?
The canonical SMILES for cesium methyl carbonate is COC(=O)[O-].[Cs+].
What is the InChIKey of cesium methyl carbonate?
The InChIKey is ATQKOSLGXBFGRU-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O3.Cs/c1-5-2(3)4;/h1H3,(H,3,4);/q;+1/p-1.
What are the key properties of cesium methyl carbonate?
cesium methyl carbonate has a molecular weight of 207.95 g/mol, XLogP of -4.02, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cesium methyl carbonate is sourced from PubChem (CID 23683585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).