About sodium N-oxidobenzamide
sodium N-oxidobenzamide (PubChem CID 23684627) has the molecular formula C7H6NNaO2
and a molecular weight of 159.12 g/mol. Its IUPAC name is sodium N-oxidobenzamide.
Molecular Properties
| Compound Name | sodium N-oxidobenzamide |
| PubChem CID | 23684627 |
| Molecular Formula | C7H6NNaO2 |
| Molecular Weight | 159.12 g/mol |
| Exact Mass | 159.03 |
| IUPAC Name | sodium N-oxidobenzamide |
| SMILES | O=C(N[O-])c1ccccc1.[Na+] |
| InChI | InChI=1S/C7H6NO2.Na/c9-7(8-10)6-4-2-1-3-5-6;/h1-5H,(H-,8,9,10);/q-1;+1 |
| InChIKey | FYZUCVSCZVWCBR-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.12 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium N-oxidobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium N-oxidobenzamide?
The IUPAC name of sodium N-oxidobenzamide (CID 23684627) is sodium N-oxidobenzamide.
What is the SMILES notation for sodium N-oxidobenzamide?
The canonical SMILES for sodium N-oxidobenzamide is O=C(N[O-])c1ccccc1.[Na+].
What is the InChIKey of sodium N-oxidobenzamide?
The InChIKey is FYZUCVSCZVWCBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6NO2.Na/c9-7(8-10)6-4-2-1-3-5-6;/h1-5H,(H-,8,9,10);/q-1;+1.
What are the key properties of sodium N-oxidobenzamide?
sodium N-oxidobenzamide has a molecular weight of 159.12 g/mol, XLogP of -2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium N-oxidobenzamide is sourced from PubChem (CID 23684627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).