About potassium (9Z,12Z)-octadeca-9,12-dienoate
potassium (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 23684895) has the molecular formula C18H31KO2
and a molecular weight of 318.54 g/mol. Its IUPAC name is potassium (9Z,12Z)-octadeca-9,12-dienoate.
Molecular Properties
| Compound Name | potassium (9Z,12Z)-octadeca-9,12-dienoate |
| PubChem CID | 23684895 |
| Molecular Formula | C18H31KO2 |
| Molecular Weight | 318.54 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | potassium (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)[O-].[K+] |
| InChI | InChI=1S/C18H32O2.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20);/q;+1/p-1/b7-6-,10-9-; |
| InChIKey | BAYJYBALPIYBQQ-NBTZWHCOSA-M |
| XLogP | 1.55 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.54 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze potassium (9Z,12Z)-octadeca-9,12-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium (9Z,12Z)-octadeca-9,12-dienoate?
The IUPAC name of potassium (9Z,12Z)-octadeca-9,12-dienoate (CID 23684895) is potassium (9Z,12Z)-octadeca-9,12-dienoate.
What is the SMILES notation for potassium (9Z,12Z)-octadeca-9,12-dienoate?
The canonical SMILES for potassium (9Z,12Z)-octadeca-9,12-dienoate is CCCCC/C=C\C/C=C\CCCCCCCC(=O)[O-].[K+].
What is the InChIKey of potassium (9Z,12Z)-octadeca-9,12-dienoate?
The InChIKey is BAYJYBALPIYBQQ-NBTZWHCOSA-M. The full InChI is InChI=1S/C18H32O2.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20);/q;+1/p-1/b7-6-,10-9-;.
What are the key properties of potassium (9Z,12Z)-octadeca-9,12-dienoate?
potassium (9Z,12Z)-octadeca-9,12-dienoate has a molecular weight of 318.54 g/mol, XLogP of 1.55, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (9Z,12Z)-octadeca-9,12-dienoate is sourced from PubChem (CID 23684895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).