C22H18F2NNaO4 — CID 23685636
sodium (3R,5S,6E)-8-cyano-9,9-bis(4-fluorophenyl)-3,5-dihydroxynona-6,8-dienoate (PubChem CID 23685636) has the molecular formula C22H18F2NNaO4 and a molecular weight of 421.38 g/mol. Its IUPAC name is sodium (3R,5S,6E)-8-cyano-9,9-bis(4-fluorophenyl)-3,5-dihydroxynona-6,8-dienoate.
| Compound Name | sodium (3R,5S,6E)-8-cyano-9,9-bis(4-fluorophenyl)-3,5-dihydroxynona-6,8-dienoate |
|---|---|
| PubChem CID | 23685636 |
| Molecular Formula | C22H18F2NNaO4 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | sodium (3R,5S,6E)-8-cyano-9,9-bis(4-fluorophenyl)-3,5-dihydroxynona-6,8-dienoate |
| SMILES | N#CC(/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-])=C(c1ccc(F)cc1)c1ccc(F)cc1.[Na+] |
| InChI | InChI=1S/C22H19F2NO4.Na/c23-17-6-1-14(2-7-17)22(15-3-8-18(24)9-4-15)16(13-25)5-10-19(26)11-20(27)12-21(28)29;/h1-10,19-20,26-27H,11-12H2,(H,28,29);/q;+1/p-1/b10-5+;/t19-,20-;/m1./s1 |
| InChIKey | ODEFWXXWTFSLEH-FBLBSCIJSA-M |
| XLogP | -0.90 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|