C28H38KO13PS — CID 23685642
potassium 3-[3-(2-oxopropylsulfonyl)-2-propoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propyl hydrogen phosphate (PubChem CID 23685642) has the molecular formula C28H38KO13PS and a molecular weight of 684.74 g/mol. Its IUPAC name is potassium 3-[3-(2-oxopropylsulfonyl)-2-propoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propyl hydrogen phosphate.
| Compound Name | potassium 3-[3-(2-oxopropylsulfonyl)-2-propoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propyl hydrogen phosphate |
|---|---|
| PubChem CID | 23685642 |
| Molecular Formula | C28H38KO13PS |
| Molecular Weight | 684.74 g/mol |
| Exact Mass | 684.14 |
| IUPAC Name | potassium 3-[3-(2-oxopropylsulfonyl)-2-propoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propyl hydrogen phosphate |
| SMILES | CCCOc1c(OCCCOP(=O)([O-])O)cc([C@@H]2CC[C@@H](c3cc(OC)c(OC)c(OC)c3)O2)cc1S(=O)(=O)CC(C)=O.[K+] |
| InChI | InChI=1S/C28H39O13PS.K/c1-6-10-39-28-25(38-11-7-12-40-42(30,31)32)15-20(16-26(28)43(33,34)17-18(2)29)22-9-8-21(41-22)19-13-23(35-3)27(37-5)24(14-19)36-4;/h13-16,21-22H,6-12,17H2,1-5H3,(H2,30,31,32);/q;+1/p-1/t21-,22-;/m0./s1 |
| InChIKey | SKQBSRYLMISHKB-VROPFNGYSA-M |
| XLogP | 0.71 |
| TPSA | 176.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.74 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|