About potassium;6-methylcyclohexen-1-olate;triethylborane
potassium;6-methylcyclohexen-1-olate;triethylborane (PubChem CID 23685819) has the molecular formula C13H26BKO
and a molecular weight of 248.26 g/mol. Its IUPAC name is potassium;6-methylcyclohexen-1-olate;triethylborane.
Molecular Properties
| Compound Name | potassium;6-methylcyclohexen-1-olate;triethylborane |
| PubChem CID | 23685819 |
| Molecular Formula | C13H26BKO |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | potassium;6-methylcyclohexen-1-olate;triethylborane |
| SMILES | CC1CCCC=C1[O-].CCB(CC)CC.[K+] |
| InChI | InChI=1S/C7H12O.C6H15B.K/c1-6-4-2-3-5-7(6)8;1-4-7(5-2)6-3;/h5-6,8H,2-4H2,1H3;4-6H2,1-3H3;/q;;+1/p-1 |
| InChIKey | PHYZKXYPAWJACW-UHFFFAOYSA-M |
| XLogP | 0.60 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium;6-methylcyclohexen-1-olate;triethylborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;6-methylcyclohexen-1-olate;triethylborane?
The IUPAC name of potassium;6-methylcyclohexen-1-olate;triethylborane (CID 23685819) is potassium;6-methylcyclohexen-1-olate;triethylborane.
What is the SMILES notation for potassium;6-methylcyclohexen-1-olate;triethylborane?
The canonical SMILES for potassium;6-methylcyclohexen-1-olate;triethylborane is CC1CCCC=C1[O-].CCB(CC)CC.[K+].
What is the InChIKey of potassium;6-methylcyclohexen-1-olate;triethylborane?
The InChIKey is PHYZKXYPAWJACW-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H12O.C6H15B.K/c1-6-4-2-3-5-7(6)8;1-4-7(5-2)6-3;/h5-6,8H,2-4H2,1H3;4-6H2,1-3H3;/q;;+1/p-1.
What are the key properties of potassium;6-methylcyclohexen-1-olate;triethylborane?
potassium;6-methylcyclohexen-1-olate;triethylborane has a molecular weight of 248.26 g/mol, XLogP of 0.60, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;6-methylcyclohexen-1-olate;triethylborane is sourced from PubChem (CID 23685819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).