About potassium 2,6-dimethylphenolate
potassium 2,6-dimethylphenolate (PubChem CID 23686125) has the molecular formula C8H9KO
and a molecular weight of 160.26 g/mol. Its IUPAC name is potassium 2,6-dimethylphenolate.
Molecular Properties
| Compound Name | potassium 2,6-dimethylphenolate |
| PubChem CID | 23686125 |
| Molecular Formula | C8H9KO |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | potassium 2,6-dimethylphenolate |
| SMILES | Cc1cccc(C)c1[O-].[K+] |
| InChI | InChI=1S/C8H10O.K/c1-6-4-3-5-7(2)8(6)9;/h3-5,9H,1-2H3;/q;+1/p-1 |
| InChIKey | ZTPAYGILGMXFAV-UHFFFAOYSA-M |
| XLogP | -1.62 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze potassium 2,6-dimethylphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2,6-dimethylphenolate?
The IUPAC name of potassium 2,6-dimethylphenolate (CID 23686125) is potassium 2,6-dimethylphenolate.
What is the SMILES notation for potassium 2,6-dimethylphenolate?
The canonical SMILES for potassium 2,6-dimethylphenolate is Cc1cccc(C)c1[O-].[K+].
What is the InChIKey of potassium 2,6-dimethylphenolate?
The InChIKey is ZTPAYGILGMXFAV-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10O.K/c1-6-4-3-5-7(2)8(6)9;/h3-5,9H,1-2H3;/q;+1/p-1.
What are the key properties of potassium 2,6-dimethylphenolate?
potassium 2,6-dimethylphenolate has a molecular weight of 160.26 g/mol, XLogP of -1.62, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2,6-dimethylphenolate is sourced from PubChem (CID 23686125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).