About lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)but-3-en-1-olate
lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)but-3-en-1-olate (PubChem CID 23686260) has the molecular formula C13H19LiO
and a molecular weight of 198.23 g/mol. Its IUPAC name is lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)but-3-en-1-olate.
Molecular Properties
| Compound Name | lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)but-3-en-1-olate |
| PubChem CID | 23686260 |
| Molecular Formula | C13H19LiO |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)but-3-en-1-olate |
| SMILES | C=CC/C([O-])=C1\C(C)=CCCC1(C)C.[Li+] |
| InChI | InChI=1S/C13H20O.Li/c1-5-7-11(14)12-10(2)8-6-9-13(12,3)4;/h5,8,14H,1,6-7,9H2,2-4H3;/q;+1/p-1/b12-11-; |
| InChIKey | UJQJFWUKVCOOAJ-AFEZEDKISA-M |
| XLogP | -0.05 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)but-3-en-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)but-3-en-1-olate?
The IUPAC name of lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)but-3-en-1-olate (CID 23686260) is lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)but-3-en-1-olate.
What is the SMILES notation for lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)but-3-en-1-olate?
The canonical SMILES for lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)but-3-en-1-olate is C=CC/C([O-])=C1\C(C)=CCCC1(C)C.[Li+].
What is the InChIKey of lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)but-3-en-1-olate?
The InChIKey is UJQJFWUKVCOOAJ-AFEZEDKISA-M. The full InChI is InChI=1S/C13H20O.Li/c1-5-7-11(14)12-10(2)8-6-9-13(12,3)4;/h5,8,14H,1,6-7,9H2,2-4H3;/q;+1/p-1/b12-11-;.
What are the key properties of lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)but-3-en-1-olate?
lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)but-3-en-1-olate has a molecular weight of 198.23 g/mol, XLogP of -0.05, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)but-3-en-1-olate is sourced from PubChem (CID 23686260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).