About potassium 3-phenyl-1-thia-3-aza-4-azanidacyclopentane-2,5-dithione
potassium 3-phenyl-1-thia-3-aza-4-azanidacyclopentane-2,5-dithione (PubChem CID 23686440) has the molecular formula C8H5KN2S3
and a molecular weight of 264.44 g/mol. Its IUPAC name is potassium 3-phenyl-1-thia-3-aza-4-azanidacyclopentane-2,5-dithione.
Molecular Properties
| Compound Name | potassium 3-phenyl-1-thia-3-aza-4-azanidacyclopentane-2,5-dithione |
| PubChem CID | 23686440 |
| Molecular Formula | C8H5KN2S3 |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 263.93 |
| IUPAC Name | potassium 3-phenyl-1-thia-3-aza-4-azanidacyclopentane-2,5-dithione |
| SMILES | S=c1[n-]n(-c2ccccc2)c(=S)s1.[K+] |
| InChI | InChI=1S/C8H6N2S3.K/c11-7-9-10(8(12)13-7)6-4-2-1-3-5-6;/h1-5H,(H,9,11);/q;+1/p-1 |
| InChIKey | QSKDCVGFAPHSHX-UHFFFAOYSA-M |
| XLogP | -0.04 |
| TPSA | 19.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze potassium 3-phenyl-1-thia-3-aza-4-azanidacyclopentane-2,5-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 3-phenyl-1-thia-3-aza-4-azanidacyclopentane-2,5-dithione?
The IUPAC name of potassium 3-phenyl-1-thia-3-aza-4-azanidacyclopentane-2,5-dithione (CID 23686440) is potassium 3-phenyl-1-thia-3-aza-4-azanidacyclopentane-2,5-dithione.
What is the SMILES notation for potassium 3-phenyl-1-thia-3-aza-4-azanidacyclopentane-2,5-dithione?
The canonical SMILES for potassium 3-phenyl-1-thia-3-aza-4-azanidacyclopentane-2,5-dithione is S=c1[n-]n(-c2ccccc2)c(=S)s1.[K+].
What is the InChIKey of potassium 3-phenyl-1-thia-3-aza-4-azanidacyclopentane-2,5-dithione?
The InChIKey is QSKDCVGFAPHSHX-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H6N2S3.K/c11-7-9-10(8(12)13-7)6-4-2-1-3-5-6;/h1-5H,(H,9,11);/q;+1/p-1.
What are the key properties of potassium 3-phenyl-1-thia-3-aza-4-azanidacyclopentane-2,5-dithione?
potassium 3-phenyl-1-thia-3-aza-4-azanidacyclopentane-2,5-dithione has a molecular weight of 264.44 g/mol, XLogP of -0.04, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 3-phenyl-1-thia-3-aza-4-azanidacyclopentane-2,5-dithione is sourced from PubChem (CID 23686440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).