C10H15NaO4S — CID 23686666
sodium (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate (PubChem CID 23686666) has the molecular formula C10H15NaO4S and a molecular weight of 254.28 g/mol. Its IUPAC name is sodium (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate.
| Compound Name | sodium (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
|---|---|
| PubChem CID | 23686666 |
| Molecular Formula | C10H15NaO4S |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | sodium (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)[O-])C(=O)C2.[Na+] |
| InChI | InChI=1S/C10H16O4S.Na/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;/h7H,3-6H2,1-2H3,(H,12,13,14);/q;+1/p-1 |
| InChIKey | AWMAOFAHBPCBHJ-UHFFFAOYSA-M |
| XLogP | -2.07 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|