C7H13Cl3NO5P — CID 2368737
1-diethoxyphosphoryl-N-[(1R)-2,2,2-trichloro-1-hydroxyethyl]formamide (PubChem CID 2368737) has the molecular formula C7H13Cl3NO5P and a molecular weight of 328.52 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-N-[(1R)-2,2,2-trichloro-1-hydroxyethyl]formamide.
| Compound Name | 1-diethoxyphosphoryl-N-[(1R)-2,2,2-trichloro-1-hydroxyethyl]formamide |
|---|---|
| PubChem CID | 2368737 |
| Molecular Formula | C7H13Cl3NO5P |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 326.96 |
| IUPAC Name | 1-diethoxyphosphoryl-N-[(1R)-2,2,2-trichloro-1-hydroxyethyl]formamide |
| SMILES | CCOP(=O)(OCC)C(=O)N[C@H](O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H13Cl3NO5P/c1-3-15-17(14,16-4-2)6(13)11-5(12)7(8,9)10/h5,12H,3-4H2,1-2H3,(H,11,13)/t5-/m1/s1 |
| InChIKey | ZNOJYBJXMRHJSF-RXMQYKEDSA-N |
| XLogP | 2.65 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|