About sodium 2-phenoxyacetate
sodium 2-phenoxyacetate (PubChem CID 23687423) has the molecular formula C8H7NaO3
and a molecular weight of 174.13 g/mol. Its IUPAC name is sodium 2-phenoxyacetate.
Molecular Properties
| Compound Name | sodium 2-phenoxyacetate |
| PubChem CID | 23687423 |
| Molecular Formula | C8H7NaO3 |
| Molecular Weight | 174.13 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | sodium 2-phenoxyacetate |
| SMILES | O=C([O-])COc1ccccc1.[Na+] |
| InChI | InChI=1S/C8H8O3.Na/c9-8(10)6-11-7-4-2-1-3-5-7;/h1-5H,6H2,(H,9,10);/q;+1/p-1 |
| InChIKey | WPTJBFNYRRZIDZ-UHFFFAOYSA-M |
| XLogP | -3.18 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.13 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium 2-phenoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-phenoxyacetate?
The IUPAC name of sodium 2-phenoxyacetate (CID 23687423) is sodium 2-phenoxyacetate.
What is the SMILES notation for sodium 2-phenoxyacetate?
The canonical SMILES for sodium 2-phenoxyacetate is O=C([O-])COc1ccccc1.[Na+].
What is the InChIKey of sodium 2-phenoxyacetate?
The InChIKey is WPTJBFNYRRZIDZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8O3.Na/c9-8(10)6-11-7-4-2-1-3-5-7;/h1-5H,6H2,(H,9,10);/q;+1/p-1.
What are the key properties of sodium 2-phenoxyacetate?
sodium 2-phenoxyacetate has a molecular weight of 174.13 g/mol, XLogP of -3.18, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-phenoxyacetate is sourced from PubChem (CID 23687423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).