C16H9ClF3N5O3S — CID 2368748
(2R)-2-(5-chloro-1-ethyl-3-nitro-6-oxopyridazin-4-yl)-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]acetonitrile (PubChem CID 2368748) has the molecular formula C16H9ClF3N5O3S and a molecular weight of 443.79 g/mol. Its IUPAC name is (2R)-2-(5-chloro-1-ethyl-3-nitro-6-oxopyridazin-4-yl)-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]acetonitrile.
| Compound Name | (2R)-2-(5-chloro-1-ethyl-3-nitro-6-oxopyridazin-4-yl)-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]acetonitrile |
|---|---|
| PubChem CID | 2368748 |
| Molecular Formula | C16H9ClF3N5O3S |
| Molecular Weight | 443.79 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | (2R)-2-(5-chloro-1-ethyl-3-nitro-6-oxopyridazin-4-yl)-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]acetonitrile |
| SMILES | CCn1nc([N+](=O)[O-])c([C@H](C#N)c2nc3cc(C(F)(F)F)ccc3s2)c(Cl)c1=O |
| InChI | InChI=1S/C16H9ClF3N5O3S/c1-2-24-15(26)12(17)11(13(23-24)25(27)28)8(6-21)14-22-9-5-7(16(18,19)20)3-4-10(9)29-14/h3-5,8H,2H2,1H3/t8-/m0/s1 |
| InChIKey | SCGVTAZSAALBIZ-QMMMGPOBSA-N |
| XLogP | 4.11 |
| TPSA | 114.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.79 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|