C29H49NaO4S — CID 23687589
sodium [(3S,9R,10S,13R,14R,17R)-17-[(2R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] sulfate (PubChem CID 23687589) has the molecular formula C29H49NaO4S and a molecular weight of 516.76 g/mol. Its IUPAC name is sodium [(3S,9R,10S,13R,14R,17R)-17-[(2R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] sulfate.
| Compound Name | sodium [(3S,9R,10S,13R,14R,17R)-17-[(2R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] sulfate |
|---|---|
| PubChem CID | 23687589 |
| Molecular Formula | C29H49NaO4S |
| Molecular Weight | 516.76 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | sodium [(3S,9R,10S,13R,14R,17R)-17-[(2R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] sulfate |
| SMILES | CCC(CC[C@@H](C)[C@H]1CC[C@H]2C3=CCC4C[C@@H](OS(=O)(=O)[O-])CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C.[Na+] |
| InChI | InChI=1S/C29H50O4S.Na/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(33-34(30,31)32)14-16-28(22,5)27(24)15-17-29(25,26)6;/h11,19-23,25-27H,7-10,12-18H2,1-6H3,(H,30,31,32);/q;+1/p-1/t20-,21?,22?,23+,25-,26+,27+,28+,29-;/m1./s1 |
| InChIKey | LHZKRYYIUYCWMS-BTOARCPOSA-M |
| XLogP | 4.51 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.76 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|