About sodium;piperidine-4-carboxamide;carbamodithioate
sodium;piperidine-4-carboxamide;carbamodithioate (PubChem CID 23687884) has the molecular formula C7H14N3NaOS2
and a molecular weight of 243.33 g/mol. Its IUPAC name is sodium;piperidine-4-carboxamide;carbamodithioate.
Molecular Properties
| Compound Name | sodium;piperidine-4-carboxamide;carbamodithioate |
| PubChem CID | 23687884 |
| Molecular Formula | C7H14N3NaOS2 |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | sodium;piperidine-4-carboxamide;carbamodithioate |
| SMILES | NC(=O)C1CCNCC1.NC(=S)[S-].[Na+] |
| InChI | InChI=1S/C6H12N2O.CH3NS2.Na/c7-6(9)5-1-3-8-4-2-5;2-1(3)4;/h5,8H,1-4H2,(H2,7,9);(H3,2,3,4);/q;;+1/p-1 |
| InChIKey | RMNPLCPCJIEIRK-UHFFFAOYSA-M |
| XLogP | -3.75 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | -3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;piperidine-4-carboxamide;carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;piperidine-4-carboxamide;carbamodithioate?
The IUPAC name of sodium;piperidine-4-carboxamide;carbamodithioate (CID 23687884) is sodium;piperidine-4-carboxamide;carbamodithioate.
What is the SMILES notation for sodium;piperidine-4-carboxamide;carbamodithioate?
The canonical SMILES for sodium;piperidine-4-carboxamide;carbamodithioate is NC(=O)C1CCNCC1.NC(=S)[S-].[Na+].
What is the InChIKey of sodium;piperidine-4-carboxamide;carbamodithioate?
The InChIKey is RMNPLCPCJIEIRK-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H12N2O.CH3NS2.Na/c7-6(9)5-1-3-8-4-2-5;2-1(3)4;/h5,8H,1-4H2,(H2,7,9);(H3,2,3,4);/q;;+1/p-1.
What are the key properties of sodium;piperidine-4-carboxamide;carbamodithioate?
sodium;piperidine-4-carboxamide;carbamodithioate has a molecular weight of 243.33 g/mol, XLogP of -3.75, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;piperidine-4-carboxamide;carbamodithioate is sourced from PubChem (CID 23687884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).