About potassium 2,3-dihydroxyphenolate
potassium 2,3-dihydroxyphenolate (PubChem CID 23688909) has the molecular formula C6H5KO3
and a molecular weight of 164.20 g/mol. Its IUPAC name is potassium 2,3-dihydroxyphenolate.
Molecular Properties
| Compound Name | potassium 2,3-dihydroxyphenolate |
| PubChem CID | 23688909 |
| Molecular Formula | C6H5KO3 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 163.99 |
| IUPAC Name | potassium 2,3-dihydroxyphenolate |
| SMILES | [K+].[O-]c1cccc(O)c1O |
| InChI | InChI=1S/C6H6O3.K/c7-4-2-1-3-5(8)6(4)9;/h1-3,7-9H;/q;+1/p-1 |
| InChIKey | DZHJVFXTMQJEKR-UHFFFAOYSA-M |
| XLogP | -2.82 |
| TPSA | 63.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze potassium 2,3-dihydroxyphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2,3-dihydroxyphenolate?
The IUPAC name of potassium 2,3-dihydroxyphenolate (CID 23688909) is potassium 2,3-dihydroxyphenolate.
What is the SMILES notation for potassium 2,3-dihydroxyphenolate?
The canonical SMILES for potassium 2,3-dihydroxyphenolate is [K+].[O-]c1cccc(O)c1O.
What is the InChIKey of potassium 2,3-dihydroxyphenolate?
The InChIKey is DZHJVFXTMQJEKR-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6O3.K/c7-4-2-1-3-5(8)6(4)9;/h1-3,7-9H;/q;+1/p-1.
What are the key properties of potassium 2,3-dihydroxyphenolate?
potassium 2,3-dihydroxyphenolate has a molecular weight of 164.20 g/mol, XLogP of -2.82, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2,3-dihydroxyphenolate is sourced from PubChem (CID 23688909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).