About sodium 5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-olate
sodium 5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-olate (PubChem CID 23688967) has the molecular formula C6H5N4NaO
and a molecular weight of 172.12 g/mol. Its IUPAC name is sodium 5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-olate.
Molecular Properties
| Compound Name | sodium 5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-olate |
| PubChem CID | 23688967 |
| Molecular Formula | C6H5N4NaO |
| Molecular Weight | 172.12 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | sodium 5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-olate |
| SMILES | Cc1cc([O-])n2ncnc2n1.[Na+] |
| InChI | InChI=1S/C6H6N4O.Na/c1-4-2-5(11)10-6(9-4)7-3-8-10;/h2-3,11H,1H3;/q;+1/p-1 |
| InChIKey | SCUXDVHDVBHAIH-UHFFFAOYSA-M |
| XLogP | -3.49 |
| TPSA | 66.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.12 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze sodium 5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-olate?
The IUPAC name of sodium 5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-olate (CID 23688967) is sodium 5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-olate.
What is the SMILES notation for sodium 5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-olate?
The canonical SMILES for sodium 5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-olate is Cc1cc([O-])n2ncnc2n1.[Na+].
What is the InChIKey of sodium 5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-olate?
The InChIKey is SCUXDVHDVBHAIH-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6N4O.Na/c1-4-2-5(11)10-6(9-4)7-3-8-10;/h2-3,11H,1H3;/q;+1/p-1.
What are the key properties of sodium 5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-olate?
sodium 5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-olate has a molecular weight of 172.12 g/mol, XLogP of -3.49, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-olate is sourced from PubChem (CID 23688967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).