About sodium 2-nonylphenolate
sodium 2-nonylphenolate (PubChem CID 23688997) has the molecular formula C15H23NaO
and a molecular weight of 242.34 g/mol. Its IUPAC name is sodium 2-nonylphenolate.
Molecular Properties
| Compound Name | sodium 2-nonylphenolate |
| PubChem CID | 23688997 |
| Molecular Formula | C15H23NaO |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | sodium 2-nonylphenolate |
| SMILES | CCCCCCCCCc1ccccc1[O-].[Na+] |
| InChI | InChI=1S/C15H24O.Na/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;/h9-10,12-13,16H,2-8,11H2,1H3;/q;+1/p-1 |
| InChIKey | LGORLCOUTMVEAC-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-nonylphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-nonylphenolate?
The IUPAC name of sodium 2-nonylphenolate (CID 23688997) is sodium 2-nonylphenolate.
What is the SMILES notation for sodium 2-nonylphenolate?
The canonical SMILES for sodium 2-nonylphenolate is CCCCCCCCCc1ccccc1[O-].[Na+].
What is the InChIKey of sodium 2-nonylphenolate?
The InChIKey is LGORLCOUTMVEAC-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H24O.Na/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;/h9-10,12-13,16H,2-8,11H2,1H3;/q;+1/p-1.
What are the key properties of sodium 2-nonylphenolate?
sodium 2-nonylphenolate has a molecular weight of 242.34 g/mol, XLogP of 1.06, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-nonylphenolate is sourced from PubChem (CID 23688997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).