About sodium (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate
sodium (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 23689690) has the molecular formula C11H4Cl2F3NaO3
and a molecular weight of 335.04 g/mol. Its IUPAC name is sodium (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
Molecular Properties
| Compound Name | sodium (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| PubChem CID | 23689690 |
| Molecular Formula | C11H4Cl2F3NaO3 |
| Molecular Weight | 335.04 g/mol |
| Exact Mass | 333.94 |
| IUPAC Name | sodium (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | O=C([O-])C1=Cc2cc(Cl)cc(Cl)c2O[C@@H]1C(F)(F)F.[Na+] |
| InChI | InChI=1S/C11H5Cl2F3O3.Na/c12-5-1-4-2-6(10(17)18)9(11(14,15)16)19-8(4)7(13)3-5;/h1-3,9H,(H,17,18);/q;+1/p-1/t9-;/m0./s1 |
| InChIKey | LUZLFMRCDABHJO-FVGYRXGTSA-M |
| XLogP | -0.55 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.04 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate?
The IUPAC name of sodium (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (CID 23689690) is sodium (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
What is the SMILES notation for sodium (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate?
The canonical SMILES for sodium (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate is O=C([O-])C1=Cc2cc(Cl)cc(Cl)c2O[C@@H]1C(F)(F)F.[Na+].
What is the InChIKey of sodium (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate?
The InChIKey is LUZLFMRCDABHJO-FVGYRXGTSA-M. The full InChI is InChI=1S/C11H5Cl2F3O3.Na/c12-5-1-4-2-6(10(17)18)9(11(14,15)16)19-8(4)7(13)3-5;/h1-3,9H,(H,17,18);/q;+1/p-1/t9-;/m0./s1.
What are the key properties of sodium (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate?
sodium (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate has a molecular weight of 335.04 g/mol, XLogP of -0.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate is sourced from PubChem (CID 23689690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).