About 8-(cyclohexylamino)-2-ethyloctane-1-sulfonate;rubidium(1+)
8-(cyclohexylamino)-2-ethyloctane-1-sulfonate;rubidium(1+) (PubChem CID 23689803) has the molecular formula C16H32NO3RbS
and a molecular weight of 403.97 g/mol. Its IUPAC name is 8-(cyclohexylamino)-2-ethyloctane-1-sulfonate;rubidium(1+).
Molecular Properties
| Compound Name | 8-(cyclohexylamino)-2-ethyloctane-1-sulfonate;rubidium(1+) |
| PubChem CID | 23689803 |
| Molecular Formula | C16H32NO3RbS |
| Molecular Weight | 403.97 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 8-(cyclohexylamino)-2-ethyloctane-1-sulfonate;rubidium(1+) |
| SMILES | CCC(CCCCCCNC1CCCCC1)CS(=O)(=O)[O-].[Rb+] |
| InChI | InChI=1S/C16H33NO3S.Rb/c1-2-15(14-21(18,19)20)10-6-3-4-9-13-17-16-11-7-5-8-12-16;/h15-17H,2-14H2,1H3,(H,18,19,20);/q;+1/p-1 |
| InChIKey | DVHPTOJEKHFVDU-UHFFFAOYSA-M |
| XLogP | 0.43 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.97 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 8-(cyclohexylamino)-2-ethyloctane-1-sulfonate;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(cyclohexylamino)-2-ethyloctane-1-sulfonate;rubidium(1+)?
The IUPAC name of 8-(cyclohexylamino)-2-ethyloctane-1-sulfonate;rubidium(1+) (CID 23689803) is 8-(cyclohexylamino)-2-ethyloctane-1-sulfonate;rubidium(1+).
What is the SMILES notation for 8-(cyclohexylamino)-2-ethyloctane-1-sulfonate;rubidium(1+)?
The canonical SMILES for 8-(cyclohexylamino)-2-ethyloctane-1-sulfonate;rubidium(1+) is CCC(CCCCCCNC1CCCCC1)CS(=O)(=O)[O-].[Rb+].
What is the InChIKey of 8-(cyclohexylamino)-2-ethyloctane-1-sulfonate;rubidium(1+)?
The InChIKey is DVHPTOJEKHFVDU-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H33NO3S.Rb/c1-2-15(14-21(18,19)20)10-6-3-4-9-13-17-16-11-7-5-8-12-16;/h15-17H,2-14H2,1H3,(H,18,19,20);/q;+1/p-1.
What are the key properties of 8-(cyclohexylamino)-2-ethyloctane-1-sulfonate;rubidium(1+)?
8-(cyclohexylamino)-2-ethyloctane-1-sulfonate;rubidium(1+) has a molecular weight of 403.97 g/mol, XLogP of 0.43, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(cyclohexylamino)-2-ethyloctane-1-sulfonate;rubidium(1+) is sourced from PubChem (CID 23689803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).