C17H18F3N5NaO5PS — CID 23690742
sodium 2-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]ethoxymethyl-(2,2,2-trifluoroethoxy)phosphinate (PubChem CID 23690742) has the molecular formula C17H18F3N5NaO5PS and a molecular weight of 515.39 g/mol. Its IUPAC name is sodium 2-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]ethoxymethyl-(2,2,2-trifluoroethoxy)phosphinate.
| Compound Name | sodium 2-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]ethoxymethyl-(2,2,2-trifluoroethoxy)phosphinate |
|---|---|
| PubChem CID | 23690742 |
| Molecular Formula | C17H18F3N5NaO5PS |
| Molecular Weight | 515.39 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | sodium 2-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]ethoxymethyl-(2,2,2-trifluoroethoxy)phosphinate |
| SMILES | COc1ccc(Sc2nc(N)nc3c2ncn3CCOCP(=O)([O-])OCC(F)(F)F)cc1.[Na+] |
| InChI | InChI=1S/C17H19F3N5O5PS.Na/c1-28-11-2-4-12(5-3-11)32-15-13-14(23-16(21)24-15)25(9-22-13)6-7-29-10-31(26,27)30-8-17(18,19)20;/h2-5,9H,6-8,10H2,1H3,(H,26,27)(H2,21,23,24);/q;+1/p-1 |
| InChIKey | DRANZOHHVXIBPQ-UHFFFAOYSA-M |
| XLogP | -0.32 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.39 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|