About [2-(2,5-dimethylanilino)-2-oxoethyl] 3-methylbut-2-enoate
[2-(2,5-dimethylanilino)-2-oxoethyl] 3-methylbut-2-enoate (PubChem CID 2369102) has the molecular formula C15H19NO3
and a molecular weight of 261.32 g/mol. Its IUPAC name is [2-(2,5-dimethylanilino)-2-oxoethyl] 3-methylbut-2-enoate.
Molecular Properties
| Compound Name | [2-(2,5-dimethylanilino)-2-oxoethyl] 3-methylbut-2-enoate |
| PubChem CID | 2369102 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | [2-(2,5-dimethylanilino)-2-oxoethyl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OCC(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C15H19NO3/c1-10(2)7-15(18)19-9-14(17)16-13-8-11(3)5-6-12(13)4/h5-8H,9H2,1-4H3,(H,16,17) |
| InChIKey | JHACPVPYIGOCDM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,5-dimethylanilino)-2-oxoethyl] 3-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,5-dimethylanilino)-2-oxoethyl] 3-methylbut-2-enoate?
The IUPAC name of [2-(2,5-dimethylanilino)-2-oxoethyl] 3-methylbut-2-enoate (CID 2369102) is [2-(2,5-dimethylanilino)-2-oxoethyl] 3-methylbut-2-enoate.
What is the SMILES notation for [2-(2,5-dimethylanilino)-2-oxoethyl] 3-methylbut-2-enoate?
The canonical SMILES for [2-(2,5-dimethylanilino)-2-oxoethyl] 3-methylbut-2-enoate is CC(C)=CC(=O)OCC(=O)Nc1cc(C)ccc1C.
What is the InChIKey of [2-(2,5-dimethylanilino)-2-oxoethyl] 3-methylbut-2-enoate?
The InChIKey is JHACPVPYIGOCDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO3/c1-10(2)7-15(18)19-9-14(17)16-13-8-11(3)5-6-12(13)4/h5-8H,9H2,1-4H3,(H,16,17).
What are the key properties of [2-(2,5-dimethylanilino)-2-oxoethyl] 3-methylbut-2-enoate?
[2-(2,5-dimethylanilino)-2-oxoethyl] 3-methylbut-2-enoate has a molecular weight of 261.32 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,5-dimethylanilino)-2-oxoethyl] 3-methylbut-2-enoate is sourced from PubChem (CID 2369102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).