C18H27LiO4 — CID 23691281
lithium (4R,5R)-4,5-bis(2-methoxypropan-2-yl)-2-(phenylmethyl)-1,3-dioxolane (PubChem CID 23691281) has the molecular formula C18H27LiO4 and a molecular weight of 314.35 g/mol. Its IUPAC name is lithium (4R,5R)-4,5-bis(2-methoxypropan-2-yl)-2-(phenylmethyl)-1,3-dioxolane.
| Compound Name | lithium (4R,5R)-4,5-bis(2-methoxypropan-2-yl)-2-(phenylmethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 23691281 |
| Molecular Formula | C18H27LiO4 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | lithium (4R,5R)-4,5-bis(2-methoxypropan-2-yl)-2-(phenylmethyl)-1,3-dioxolane |
| SMILES | COC(C)(C)[C@@H]1OC(Cc2c[c-]ccc2)O[C@H]1C(C)(C)OC.[Li+] |
| InChI | InChI=1S/C18H27O4.Li/c1-17(2,19-5)15-16(18(3,4)20-6)22-14(21-15)12-13-10-8-7-9-11-13;/h7-8,10-11,14-16H,12H2,1-6H3;/q-1;+1/t15-,16-;/m1./s1 |
| InChIKey | RHEAPLWGOQANLW-QNBGGDODSA-N |
| XLogP | -0.01 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|