C14H22LiNO2 — CID 23691309
lithium tert-butyl 4-butyl-3,4-dihydropyridin-3-ide-1-carboxylate (PubChem CID 23691309) has the molecular formula C14H22LiNO2 and a molecular weight of 243.28 g/mol. Its IUPAC name is lithium tert-butyl 4-butyl-3,4-dihydropyridin-3-ide-1-carboxylate.
| Compound Name | lithium tert-butyl 4-butyl-3,4-dihydropyridin-3-ide-1-carboxylate |
|---|---|
| PubChem CID | 23691309 |
| Molecular Formula | C14H22LiNO2 |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | lithium tert-butyl 4-butyl-3,4-dihydropyridin-3-ide-1-carboxylate |
| SMILES | CCCCC1[C-]=CN(C(=O)OC(C)(C)C)C=C1.[Li+] |
| InChI | InChI=1S/C14H22NO2.Li/c1-5-6-7-12-8-10-15(11-9-12)13(16)17-14(2,3)4;/h8,10-12H,5-7H2,1-4H3;/q-1;+1 |
| InChIKey | YTYBXHSCAQWICU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|