C14H9N2NaO7S — CID 23691993
sodium 4,8-diamino-1,5-dihydroxy-9,10-dioxoanthracene-2-sulfonate (PubChem CID 23691993) has the molecular formula C14H9N2NaO7S and a molecular weight of 372.29 g/mol. Its IUPAC name is sodium 4,8-diamino-1,5-dihydroxy-9,10-dioxoanthracene-2-sulfonate.
| Compound Name | sodium 4,8-diamino-1,5-dihydroxy-9,10-dioxoanthracene-2-sulfonate |
|---|---|
| PubChem CID | 23691993 |
| Molecular Formula | C14H9N2NaO7S |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | sodium 4,8-diamino-1,5-dihydroxy-9,10-dioxoanthracene-2-sulfonate |
| SMILES | Nc1ccc(O)c2c1C(=O)c1c(O)c(S(=O)(=O)[O-])cc(N)c1C2=O.[Na+] |
| InChI | InChI=1S/C14H10N2O7S.Na/c15-4-1-2-6(17)10-8(4)14(20)11-9(13(10)19)5(16)3-7(12(11)18)24(21,22)23;/h1-3,17-18H,15-16H2,(H,21,22,23);/q;+1/p-1 |
| InChIKey | CKMPIIPZKJISCU-UHFFFAOYSA-M |
| XLogP | -3.05 |
| TPSA | 183.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|