About sodium (4-aminophenyl)sulfonyl-(4-ethyl-1,3-thiazol-2-yl)azanide
sodium (4-aminophenyl)sulfonyl-(4-ethyl-1,3-thiazol-2-yl)azanide (PubChem CID 23692298) has the molecular formula C11H12N3NaO2S2
and a molecular weight of 305.36 g/mol. Its IUPAC name is sodium (4-aminophenyl)sulfonyl-(4-ethyl-1,3-thiazol-2-yl)azanide.
Molecular Properties
| Compound Name | sodium (4-aminophenyl)sulfonyl-(4-ethyl-1,3-thiazol-2-yl)azanide |
| PubChem CID | 23692298 |
| Molecular Formula | C11H12N3NaO2S2 |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | sodium (4-aminophenyl)sulfonyl-(4-ethyl-1,3-thiazol-2-yl)azanide |
| SMILES | CCc1csc([N-]S(=O)(=O)c2ccc(N)cc2)n1.[Na+] |
| InChI | InChI=1S/C11H12N3O2S2.Na/c1-2-9-7-17-11(13-9)14-18(15,16)10-5-3-8(12)4-6-10;/h3-7H,2,12H2,1H3;/q-1;+1 |
| InChIKey | FRLNZMQBNCIHJM-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze sodium (4-aminophenyl)sulfonyl-(4-ethyl-1,3-thiazol-2-yl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (4-aminophenyl)sulfonyl-(4-ethyl-1,3-thiazol-2-yl)azanide?
The IUPAC name of sodium (4-aminophenyl)sulfonyl-(4-ethyl-1,3-thiazol-2-yl)azanide (CID 23692298) is sodium (4-aminophenyl)sulfonyl-(4-ethyl-1,3-thiazol-2-yl)azanide.
What is the SMILES notation for sodium (4-aminophenyl)sulfonyl-(4-ethyl-1,3-thiazol-2-yl)azanide?
The canonical SMILES for sodium (4-aminophenyl)sulfonyl-(4-ethyl-1,3-thiazol-2-yl)azanide is CCc1csc([N-]S(=O)(=O)c2ccc(N)cc2)n1.[Na+].
What is the InChIKey of sodium (4-aminophenyl)sulfonyl-(4-ethyl-1,3-thiazol-2-yl)azanide?
The InChIKey is FRLNZMQBNCIHJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N3O2S2.Na/c1-2-9-7-17-11(13-9)14-18(15,16)10-5-3-8(12)4-6-10;/h3-7H,2,12H2,1H3;/q-1;+1.
What are the key properties of sodium (4-aminophenyl)sulfonyl-(4-ethyl-1,3-thiazol-2-yl)azanide?
sodium (4-aminophenyl)sulfonyl-(4-ethyl-1,3-thiazol-2-yl)azanide has a molecular weight of 305.36 g/mol, XLogP of -0.31, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (4-aminophenyl)sulfonyl-(4-ethyl-1,3-thiazol-2-yl)azanide is sourced from PubChem (CID 23692298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).