C16H22NaO7P — CID 23692352
sodium [3-(5-tert-butyl-4,4-dimethyl-2,6,7-trioxabicyclo[3.2.0]heptan-1-yl)phenyl] hydrogen phosphate (PubChem CID 23692352) has the molecular formula C16H22NaO7P and a molecular weight of 380.31 g/mol. Its IUPAC name is sodium [3-(5-tert-butyl-4,4-dimethyl-2,6,7-trioxabicyclo[3.2.0]heptan-1-yl)phenyl] hydrogen phosphate.
| Compound Name | sodium [3-(5-tert-butyl-4,4-dimethyl-2,6,7-trioxabicyclo[3.2.0]heptan-1-yl)phenyl] hydrogen phosphate |
|---|---|
| PubChem CID | 23692352 |
| Molecular Formula | C16H22NaO7P |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | sodium [3-(5-tert-butyl-4,4-dimethyl-2,6,7-trioxabicyclo[3.2.0]heptan-1-yl)phenyl] hydrogen phosphate |
| SMILES | CC(C)(C)C12OOC1(c1cccc(OP(=O)([O-])O)c1)OCC2(C)C.[Na+] |
| InChI | InChI=1S/C16H23O7P.Na/c1-13(2,3)16-14(4,5)10-20-15(16,22-23-16)11-7-6-8-12(9-11)21-24(17,18)19;/h6-9H,10H2,1-5H3,(H2,17,18,19);/q;+1/p-1 |
| InChIKey | VEVCLXLMVQQEPM-UHFFFAOYSA-M |
| XLogP | -0.51 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|