C25H23Cl2N4NaO5 — CID 23692726
sodium 4,6-dichloro-3-[(E)-3-[4-[(oxan-4-ylcarbamoylamino)methyl]anilino]-3-oxoprop-1-enyl]-1H-indole-2-carboxylate (PubChem CID 23692726) has the molecular formula C25H23Cl2N4NaO5 and a molecular weight of 553.38 g/mol. Its IUPAC name is sodium 4,6-dichloro-3-[(E)-3-[4-[(oxan-4-ylcarbamoylamino)methyl]anilino]-3-oxoprop-1-enyl]-1H-indole-2-carboxylate.
| Compound Name | sodium 4,6-dichloro-3-[(E)-3-[4-[(oxan-4-ylcarbamoylamino)methyl]anilino]-3-oxoprop-1-enyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 23692726 |
| Molecular Formula | C25H23Cl2N4NaO5 |
| Molecular Weight | 553.38 g/mol |
| Exact Mass | 552.09 |
| IUPAC Name | sodium 4,6-dichloro-3-[(E)-3-[4-[(oxan-4-ylcarbamoylamino)methyl]anilino]-3-oxoprop-1-enyl]-1H-indole-2-carboxylate |
| SMILES | O=C(/C=C/c1c(C(=O)[O-])[nH]c2cc(Cl)cc(Cl)c12)Nc1ccc(CNC(=O)NC2CCOCC2)cc1.[Na+] |
| InChI | InChI=1S/C25H24Cl2N4O5.Na/c26-15-11-19(27)22-18(23(24(33)34)31-20(22)12-15)5-6-21(32)29-16-3-1-14(2-4-16)13-28-25(35)30-17-7-9-36-10-8-17;/h1-6,11-12,17,31H,7-10,13H2,(H,29,32)(H,33,34)(H2,28,30,35);/q;+1/p-1/b6-5+; |
| InChIKey | GSLOQUKHCJXLSR-IPZCTEOASA-M |
| XLogP | 0.47 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|