sodium oxido-oxo-propoxysilane

C3H7NaO3Si — CID 23692741

IUPACsodium oxido-oxo-propoxysilane
SMILESCCCO[Si](=O)[O-].[Na+]
InChIInChI=1S/C3H7O3Si.Na/c1-2-3-6-7(4)5;/h2-3H2,1H3;/q-1;+1
InChIKeyBPGFIYWXDSHRAX-UHFFFAOYSA-N
MW142.16 g/mol
LogP-3.81
Rot. Bonds3

About sodium oxido-oxo-propoxysilane

sodium oxido-oxo-propoxysilane (PubChem CID 23692741) has the molecular formula C3H7NaO3Si and a molecular weight of 142.16 g/mol. Its IUPAC name is sodium oxido-oxo-propoxysilane.

Molecular Properties

Compound Namesodium oxido-oxo-propoxysilane
PubChem CID23692741
Molecular FormulaC3H7NaO3Si
Molecular Weight142.16 g/mol
Exact Mass142.01
IUPAC Namesodium oxido-oxo-propoxysilane
SMILESCCCO[Si](=O)[O-].[Na+]
InChIInChI=1S/C3H7O3Si.Na/c1-2-3-6-7(4)5;/h2-3H2,1H3;/q-1;+1
InChIKeyBPGFIYWXDSHRAX-UHFFFAOYSA-N
XLogP-3.81
TPSA49.36 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.16
LogP ≤ 5-3.81
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze sodium oxido-oxo-propoxysilane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium oxido-oxo-propoxysilane?
The IUPAC name of sodium oxido-oxo-propoxysilane (CID 23692741) is sodium oxido-oxo-propoxysilane.
What is the SMILES notation for sodium oxido-oxo-propoxysilane?
The canonical SMILES for sodium oxido-oxo-propoxysilane is CCCO[Si](=O)[O-].[Na+].
What is the InChIKey of sodium oxido-oxo-propoxysilane?
The InChIKey is BPGFIYWXDSHRAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7O3Si.Na/c1-2-3-6-7(4)5;/h2-3H2,1H3;/q-1;+1.
What are the key properties of sodium oxido-oxo-propoxysilane?
sodium oxido-oxo-propoxysilane has a molecular weight of 142.16 g/mol, XLogP of -3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium oxido-oxo-propoxysilane is sourced from PubChem (CID 23692741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).