About sodium 4-prop-2-enylphenolate
sodium 4-prop-2-enylphenolate (PubChem CID 23693215) has the molecular formula C9H9NaO
and a molecular weight of 156.16 g/mol. Its IUPAC name is sodium 4-prop-2-enylphenolate.
Molecular Properties
| Compound Name | sodium 4-prop-2-enylphenolate |
| PubChem CID | 23693215 |
| Molecular Formula | C9H9NaO |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | sodium 4-prop-2-enylphenolate |
| SMILES | C=CCc1ccc([O-])cc1.[Na+] |
| InChI | InChI=1S/C9H10O.Na/c1-2-3-8-4-6-9(10)7-5-8;/h2,4-7,10H,1,3H2;/q;+1/p-1 |
| InChIKey | KNPYUVMFIRIWFX-UHFFFAOYSA-M |
| XLogP | -1.51 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze sodium 4-prop-2-enylphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-prop-2-enylphenolate?
The IUPAC name of sodium 4-prop-2-enylphenolate (CID 23693215) is sodium 4-prop-2-enylphenolate.
What is the SMILES notation for sodium 4-prop-2-enylphenolate?
The canonical SMILES for sodium 4-prop-2-enylphenolate is C=CCc1ccc([O-])cc1.[Na+].
What is the InChIKey of sodium 4-prop-2-enylphenolate?
The InChIKey is KNPYUVMFIRIWFX-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H10O.Na/c1-2-3-8-4-6-9(10)7-5-8;/h2,4-7,10H,1,3H2;/q;+1/p-1.
What are the key properties of sodium 4-prop-2-enylphenolate?
sodium 4-prop-2-enylphenolate has a molecular weight of 156.16 g/mol, XLogP of -1.51, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-prop-2-enylphenolate is sourced from PubChem (CID 23693215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).