sodium 4-prop-2-enylphenolate

C9H9NaO — CID 23693215

IUPACsodium 4-prop-2-enylphenolate
SMILESC=CCc1ccc([O-])cc1.[Na+]
InChIInChI=1S/C9H10O.Na/c1-2-3-8-4-6-9(10)7-5-8;/h2,4-7,10H,1,3H2;/q;+1/p-1
InChIKeyKNPYUVMFIRIWFX-UHFFFAOYSA-M
MW156.16 g/mol
LogP-1.51
Rot. Bonds2

About sodium 4-prop-2-enylphenolate

sodium 4-prop-2-enylphenolate (PubChem CID 23693215) has the molecular formula C9H9NaO and a molecular weight of 156.16 g/mol. Its IUPAC name is sodium 4-prop-2-enylphenolate.

Molecular Properties

Compound Namesodium 4-prop-2-enylphenolate
PubChem CID23693215
Molecular FormulaC9H9NaO
Molecular Weight156.16 g/mol
Exact Mass156.06
IUPAC Namesodium 4-prop-2-enylphenolate
SMILESC=CCc1ccc([O-])cc1.[Na+]
InChIInChI=1S/C9H10O.Na/c1-2-3-8-4-6-9(10)7-5-8;/h2,4-7,10H,1,3H2;/q;+1/p-1
InChIKeyKNPYUVMFIRIWFX-UHFFFAOYSA-M
XLogP-1.51
TPSA23.06 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.16
LogP ≤ 5-1.51
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze sodium 4-prop-2-enylphenolate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 4-prop-2-enylphenolate?
The IUPAC name of sodium 4-prop-2-enylphenolate (CID 23693215) is sodium 4-prop-2-enylphenolate.
What is the SMILES notation for sodium 4-prop-2-enylphenolate?
The canonical SMILES for sodium 4-prop-2-enylphenolate is C=CCc1ccc([O-])cc1.[Na+].
What is the InChIKey of sodium 4-prop-2-enylphenolate?
The InChIKey is KNPYUVMFIRIWFX-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H10O.Na/c1-2-3-8-4-6-9(10)7-5-8;/h2,4-7,10H,1,3H2;/q;+1/p-1.
What are the key properties of sodium 4-prop-2-enylphenolate?
sodium 4-prop-2-enylphenolate has a molecular weight of 156.16 g/mol, XLogP of -1.51, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-prop-2-enylphenolate is sourced from PubChem (CID 23693215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).